C5H7NO3S — CID 142872686
1-(sulfanylcarbonylamino)cyclopropane-1-carboxylic acid (PubChem CID 142872686) has the molecular formula C5H7NO3S and a molecular weight of 161.18 g/mol. Its IUPAC name is 1-(sulfanylcarbonylamino)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(sulfanylcarbonylamino)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 142872686 |
| Molecular Formula | C5H7NO3S |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 1-(sulfanylcarbonylamino)cyclopropane-1-carboxylic acid |
| SMILES | O=C(S)NC1(C(=O)O)CC1 |
| InChI | InChI=1S/C5H7NO3S/c7-3(8)5(1-2-5)6-4(9)10/h1-2H2,(H,7,8)(H2,6,9,10) |
| InChIKey | CHOPOOPSGAYIHK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|