C19H30N2O3 — CID 142873979
N-[3-[(1,1-dimethyl-6-propan-2-yloxy-3,4-dihydroisochromen-4-yl)amino]propyl]acetamide (PubChem CID 142873979) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[3-[(1,1-dimethyl-6-propan-2-yloxy-3,4-dihydroisochromen-4-yl)amino]propyl]acetamide.
| Compound Name | N-[3-[(1,1-dimethyl-6-propan-2-yloxy-3,4-dihydroisochromen-4-yl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 142873979 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-[3-[(1,1-dimethyl-6-propan-2-yloxy-3,4-dihydroisochromen-4-yl)amino]propyl]acetamide |
| SMILES | CC(=O)NCCCNC1COC(C)(C)c2ccc(OC(C)C)cc21 |
| InChI | InChI=1S/C19H30N2O3/c1-13(2)24-15-7-8-17-16(11-15)18(12-23-19(17,4)5)21-10-6-9-20-14(3)22/h7-8,11,13,18,21H,6,9-10,12H2,1-5H3,(H,20,22) |
| InChIKey | RALOHCBJVGBJNG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|