C14H17BrN6O3S — CID 142874904
3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]-N-methyl-5-nitrobenzenesulfinamide (PubChem CID 142874904) has the molecular formula C14H17BrN6O3S and a molecular weight of 429.30 g/mol. Its IUPAC name is 3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]-N-methyl-5-nitrobenzenesulfinamide.
| Compound Name | 3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]-N-methyl-5-nitrobenzenesulfinamide |
|---|---|
| PubChem CID | 142874904 |
| Molecular Formula | C14H17BrN6O3S |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]-N-methyl-5-nitrobenzenesulfinamide |
| SMILES | CCCNc1nc(Nc2cc([N+](=O)[O-])cc(S(=O)NC)c2)ncc1Br |
| InChI | InChI=1S/C14H17BrN6O3S/c1-3-4-17-13-12(15)8-18-14(20-13)19-9-5-10(21(22)23)7-11(6-9)25(24)16-2/h5-8,16H,3-4H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | LPYGGDSGGXOQBC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|