C9H11N3 — CID 142875293
3-[(1Z)-buta-1,3-dienyl]-4-[(Z)-prop-1-enyl]-1,2,4-triazole (PubChem CID 142875293) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-4-[(Z)-prop-1-enyl]-1,2,4-triazole.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-4-[(Z)-prop-1-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 142875293 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-4-[(Z)-prop-1-enyl]-1,2,4-triazole |
| SMILES | C=C/C=C\c1nncn1/C=C\C |
| InChI | InChI=1S/C9H11N3/c1-3-5-6-9-11-10-8-12(9)7-4-2/h3-8H,1H2,2H3/b6-5-,7-4- |
| InChIKey | FIUVDBIGHBGVBU-RNPBPNGMSA-N |
| XLogP | 1.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|