About (4Z)-3-methyliminohepta-4,6-dien-2-one;propane
(4Z)-3-methyliminohepta-4,6-dien-2-one;propane (PubChem CID 142875307) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (4Z)-3-methyliminohepta-4,6-dien-2-one;propane.
Molecular Properties
| Compound Name | (4Z)-3-methyliminohepta-4,6-dien-2-one;propane |
| PubChem CID | 142875307 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4Z)-3-methyliminohepta-4,6-dien-2-one;propane |
| SMILES | C=C/C=C\C(=N\C)C(C)=O.CCC |
| InChI | InChI=1S/C8H11NO.C3H8/c1-4-5-6-8(9-3)7(2)10;1-3-2/h4-6H,1H2,2-3H3;3H2,1-2H3/b6-5-,9-8-; |
| InChIKey | QPUAKRUGXNJGRP-YYYWGHDMSA-N |
| XLogP | 2.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-3-methyliminohepta-4,6-dien-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-3-methyliminohepta-4,6-dien-2-one;propane?
The IUPAC name of (4Z)-3-methyliminohepta-4,6-dien-2-one;propane (CID 142875307) is (4Z)-3-methyliminohepta-4,6-dien-2-one;propane.
What is the SMILES notation for (4Z)-3-methyliminohepta-4,6-dien-2-one;propane?
The canonical SMILES for (4Z)-3-methyliminohepta-4,6-dien-2-one;propane is C=C/C=C\C(=N\C)C(C)=O.CCC.
What is the InChIKey of (4Z)-3-methyliminohepta-4,6-dien-2-one;propane?
The InChIKey is QPUAKRUGXNJGRP-YYYWGHDMSA-N. The full InChI is InChI=1S/C8H11NO.C3H8/c1-4-5-6-8(9-3)7(2)10;1-3-2/h4-6H,1H2,2-3H3;3H2,1-2H3/b6-5-,9-8-;.
What are the key properties of (4Z)-3-methyliminohepta-4,6-dien-2-one;propane?
(4Z)-3-methyliminohepta-4,6-dien-2-one;propane has a molecular weight of 181.28 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3-methyliminohepta-4,6-dien-2-one;propane is sourced from PubChem (CID 142875307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).