C11H19NO — CID 142875307
(4Z)-3-methyliminohepta-4,6-dien-2-one;propane (PubChem CID 142875307) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4Z)-3-methyliminohepta-4,6-dien-2-one;propane.
| Compound Name | (4Z)-3-methyliminohepta-4,6-dien-2-one;propane |
|---|---|
| PubChem CID | 142875307 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4Z)-3-methyliminohepta-4,6-dien-2-one;propane |
| SMILES | C=C/C=C\C(=N\C)C(C)=O.CCC |
| InChI | InChI=1S/C8H11NO.C3H8/c1-4-5-6-8(9-3)7(2)10;1-3-2/h4-6H,1H2,2-3H3;3H2,1-2H3/b6-5-,9-8-; |
| InChIKey | QPUAKRUGXNJGRP-YYYWGHDMSA-N |
| XLogP | 2.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|