C9H9NO — CID 91417784
1-(azocin-2-yl)ethanone (PubChem CID 91417784) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-(azocin-2-yl)ethanone.
| Compound Name | 1-(azocin-2-yl)ethanone |
|---|---|
| PubChem CID | 91417784 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-(azocin-2-yl)ethanone |
| SMILES | CC(=O)/C1=N/C=CC=CC=C1 |
| InChI | InChI=1S/C9H9NO/c1-8(11)9-6-4-2-3-5-7-10-9/h2-7H,1H3/b3-2?,4-2?,5-3?,6-4?,7-5?,9-6?,10-7?,10-9+ |
| InChIKey | BMTQKFFGLBYTDM-HVDBHLDVSA-N |
| XLogP | 1.66 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |