C12H22NO4+ — CID 142875993
1,4-dimethylpiperidin-1-ium;(E)-2-methylbut-2-enedioic acid (PubChem CID 142875993) has the molecular formula C12H22NO4+ and a molecular weight of 244.31 g/mol. Its IUPAC name is 1,4-dimethylpiperidin-1-ium;(E)-2-methylbut-2-enedioic acid.
| Compound Name | 1,4-dimethylpiperidin-1-ium;(E)-2-methylbut-2-enedioic acid |
|---|---|
| PubChem CID | 142875993 |
| Molecular Formula | C12H22NO4+ |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1,4-dimethylpiperidin-1-ium;(E)-2-methylbut-2-enedioic acid |
| SMILES | C/C(=C\C(=O)O)C(=O)O.CC1CC[NH+](C)CC1 |
| InChI | InChI=1S/C7H15N.C5H6O4/c1-7-3-5-8(2)6-4-7;1-3(5(8)9)2-4(6)7/h7H,3-6H2,1-2H3;2H,1H3,(H,6,7)(H,8,9)/p+1/b;3-2+ |
| InChIKey | GRUIYXFYGRHCJU-ZPYUXNTASA-O |
| XLogP | 0.03 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|