C12H22NO3+ — CID 142961314
1,4-dimethylpiperidin-1-ium;(2E)-4-hydroxypenta-2,4-dienoic acid (PubChem CID 142961314) has the molecular formula C12H22NO3+ and a molecular weight of 228.31 g/mol. Its IUPAC name is 1,4-dimethylpiperidin-1-ium;(2E)-4-hydroxypenta-2,4-dienoic acid.
| Compound Name | 1,4-dimethylpiperidin-1-ium;(2E)-4-hydroxypenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 142961314 |
| Molecular Formula | C12H22NO3+ |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1,4-dimethylpiperidin-1-ium;(2E)-4-hydroxypenta-2,4-dienoic acid |
| SMILES | C=C(O)/C=C/C(=O)O.CC1CC[NH+](C)CC1 |
| InChI | InChI=1S/C7H15N.C5H6O3/c1-7-3-5-8(2)6-4-7;1-4(6)2-3-5(7)8/h7H,3-6H2,1-2H3;2-3,6H,1H2,(H,7,8)/p+1/b;3-2+ |
| InChIKey | ANETYUBRTNEAPI-ZPYUXNTASA-O |
| XLogP | 0.63 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|