C12H24NO4+ — CID 142876154
1,4-dimethylpiperidin-1-ium;methanol;(E)-4-oxobut-2-enoic acid (PubChem CID 142876154) has the molecular formula C12H24NO4+ and a molecular weight of 246.33 g/mol. Its IUPAC name is 1,4-dimethylpiperidin-1-ium;methanol;(E)-4-oxobut-2-enoic acid.
| Compound Name | 1,4-dimethylpiperidin-1-ium;methanol;(E)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 142876154 |
| Molecular Formula | C12H24NO4+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1,4-dimethylpiperidin-1-ium;methanol;(E)-4-oxobut-2-enoic acid |
| SMILES | CC1CC[NH+](C)CC1.CO.O=C/C=C/C(=O)O |
| InChI | InChI=1S/C7H15N.C4H4O3.CH4O/c1-7-3-5-8(2)6-4-7;5-3-1-2-4(6)7;1-2/h7H,3-6H2,1-2H3;1-3H,(H,6,7);2H,1H3/p+1/b;2-1+; |
| InChIKey | KBVCVKIAMNOWGS-JITBQSAISA-O |
| XLogP | -0.63 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|