C24H30N2O2S — CID 142876469
ethane;4-[2-methyl-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]cyclohepta-1,3,5-triene-1-carboxamide (PubChem CID 142876469) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is ethane;4-[2-methyl-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]cyclohepta-1,3,5-triene-1-carboxamide.
| Compound Name | ethane;4-[2-methyl-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]cyclohepta-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 142876469 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | ethane;4-[2-methyl-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]cyclohepta-1,3,5-triene-1-carboxamide |
| SMILES | CC.Cc1cc(CNCCc2cccs2)ccc1OC1=CC=C(C(N)=O)CC=C1 |
| InChI | InChI=1S/C22H24N2O2S.C2H6/c1-16-14-17(15-24-12-11-20-6-3-13-27-20)7-10-21(16)26-19-5-2-4-18(8-9-19)22(23)25;1-2/h2-3,5-10,13-14,24H,4,11-12,15H2,1H3,(H2,23,25);1-2H3 |
| InChIKey | PDTLKJJRPUSTPT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|