C9H13N — CID 142879506
4-ethenyl-6-methylcyclohexa-2,4-dien-1-amine (PubChem CID 142879506) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 4-ethenyl-6-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-ethenyl-6-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142879506 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 4-ethenyl-6-methylcyclohexa-2,4-dien-1-amine |
| SMILES | C=CC1=CC(C)C(N)C=C1 |
| InChI | InChI=1S/C9H13N/c1-3-8-4-5-9(10)7(2)6-8/h3-7,9H,1,10H2,2H3 |
| InChIKey | HOMLOJZLOIQLBJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |