C14H28O6 — CID 142879767
1-[4-(2-methoxypropan-2-yloxy)-5-methyloxolan-2-yl]ethanone;propane-2,2-diol (PubChem CID 142879767) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-[4-(2-methoxypropan-2-yloxy)-5-methyloxolan-2-yl]ethanone;propane-2,2-diol.
| Compound Name | 1-[4-(2-methoxypropan-2-yloxy)-5-methyloxolan-2-yl]ethanone;propane-2,2-diol |
|---|---|
| PubChem CID | 142879767 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-[4-(2-methoxypropan-2-yloxy)-5-methyloxolan-2-yl]ethanone;propane-2,2-diol |
| SMILES | CC(C)(O)O.COC(C)(C)OC1CC(C(C)=O)OC1C |
| InChI | InChI=1S/C11H20O4.C3H8O2/c1-7(12)9-6-10(8(2)14-9)15-11(3,4)13-5;1-3(2,4)5/h8-10H,6H2,1-5H3;4-5H,1-2H3 |
| InChIKey | HFLPETWPNKGCLA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|