C22H37NO2 — CID 142881740
(5,6-dimethoxy-3-methylidene-1,2-dihydroinden-2-yl)methanamine;nonane (PubChem CID 142881740) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is (5,6-dimethoxy-3-methylidene-1,2-dihydroinden-2-yl)methanamine;nonane.
| Compound Name | (5,6-dimethoxy-3-methylidene-1,2-dihydroinden-2-yl)methanamine;nonane |
|---|---|
| PubChem CID | 142881740 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | (5,6-dimethoxy-3-methylidene-1,2-dihydroinden-2-yl)methanamine;nonane |
| SMILES | C=C1c2cc(OC)c(OC)cc2CC1CN.CCCCCCCCC |
| InChI | InChI=1S/C13H17NO2.C9H20/c1-8-10(7-14)4-9-5-12(15-2)13(16-3)6-11(8)9;1-3-5-7-9-8-6-4-2/h5-6,10H,1,4,7,14H2,2-3H3;3-9H2,1-2H3 |
| InChIKey | SXBQNWILIKVWFQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|