C14H21N3O — CID 142883982
ethane;2-pentan-3-yl-4-pyridazin-3-yl-1,3-oxazole (PubChem CID 142883982) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is ethane;2-pentan-3-yl-4-pyridazin-3-yl-1,3-oxazole.
| Compound Name | ethane;2-pentan-3-yl-4-pyridazin-3-yl-1,3-oxazole |
|---|---|
| PubChem CID | 142883982 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | ethane;2-pentan-3-yl-4-pyridazin-3-yl-1,3-oxazole |
| SMILES | CC.CCC(CC)c1nc(-c2cccnn2)co1 |
| InChI | InChI=1S/C12H15N3O.C2H6/c1-3-9(4-2)12-14-11(8-16-12)10-6-5-7-13-15-10;1-2/h5-9H,3-4H2,1-2H3;1-2H3 |
| InChIKey | VVKYPYWPVIZIGE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |