C12H12N4 — CID 142484556
6-pyridazin-3-yl-1,2,3,4-tetrahydro-1,5-naphthyridine (PubChem CID 142484556) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 6-pyridazin-3-yl-1,2,3,4-tetrahydro-1,5-naphthyridine.
| Compound Name | 6-pyridazin-3-yl-1,2,3,4-tetrahydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 142484556 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 6-pyridazin-3-yl-1,2,3,4-tetrahydro-1,5-naphthyridine |
| SMILES | c1cnnc(-c2ccc3c(n2)CCCN3)c1 |
| InChI | InChI=1S/C12H12N4/c1-3-10-9(13-7-1)5-6-11(15-10)12-4-2-8-14-16-12/h2,4-6,8,13H,1,3,7H2 |
| InChIKey | IZPVIMWAXYQJKY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |