C14H18N2O4 — CID 155738960
dimethyl 2-methyl-2-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)propanedioate (PubChem CID 155738960) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is dimethyl 2-methyl-2-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)propanedioate.
| Compound Name | dimethyl 2-methyl-2-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)propanedioate |
|---|---|
| PubChem CID | 155738960 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | dimethyl 2-methyl-2-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)propanedioate |
| SMILES | COC(=O)C(C)(C(=O)OC)c1ccc2c(n1)CCCN2 |
| InChI | InChI=1S/C14H18N2O4/c1-14(12(17)19-2,13(18)20-3)11-7-6-9-10(16-11)5-4-8-15-9/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | YTFXGHASKAHVPA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|