C9H12N4O — CID 135388640
5,6,7,8-tetrahydro-1,5-naphthyridine-2-carbohydrazide (PubChem CID 135388640) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carbohydrazide.
| Compound Name | 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 135388640 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5,6,7,8-tetrahydro-1,5-naphthyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1ccc2c(n1)CCCN2 |
| InChI | InChI=1S/C9H12N4O/c10-13-9(14)8-4-3-6-7(12-8)2-1-5-11-6/h3-4,11H,1-2,5,10H2,(H,13,14) |
| InChIKey | XACZGWNUTMBYML-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|