C22H33N3O5 — CID 175199883
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]but-2-enoate (PubChem CID 175199883) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]but-2-enoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]but-2-enoate |
|---|---|
| PubChem CID | 175199883 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]but-2-enoate |
| SMILES | COC(=O)C(=CCOCCCCc1ccc2c(n1)CCCN2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33N3O5/c1-22(2,3)30-21(27)25-19(20(26)28-4)12-15-29-14-6-5-8-16-10-11-17-18(24-16)9-7-13-23-17/h10-12,23H,5-9,13-15H2,1-4H3,(H,25,27) |
| InChIKey | WVQSRHUWHBOFLH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|