C17H20N2 — CID 91313301
6-(2-phenylpropyl)-1,2,3,4-tetrahydro-1,5-naphthyridine (PubChem CID 91313301) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 6-(2-phenylpropyl)-1,2,3,4-tetrahydro-1,5-naphthyridine.
| Compound Name | 6-(2-phenylpropyl)-1,2,3,4-tetrahydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 91313301 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 6-(2-phenylpropyl)-1,2,3,4-tetrahydro-1,5-naphthyridine |
| SMILES | CC(Cc1ccc2c(n1)CCCN2)c1ccccc1 |
| InChI | InChI=1S/C17H20N2/c1-13(14-6-3-2-4-7-14)12-15-9-10-16-17(19-15)8-5-11-18-16/h2-4,6-7,9-10,13,18H,5,8,11-12H2,1H3 |
| InChIKey | KKXJQJXUUHUFFI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |