C16H30N2O — CID 142884980
4-[2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)ethyl]cyclohexan-1-amine (PubChem CID 142884980) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 4-[2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 4-[2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 142884980 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 4-[2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)ethyl]cyclohexan-1-amine |
| SMILES | CC1CCC2OC(CCC3CCC(N)CC3)NC2C1 |
| InChI | InChI=1S/C16H30N2O/c1-11-2-8-15-14(10-11)18-16(19-15)9-5-12-3-6-13(17)7-4-12/h11-16,18H,2-10,17H2,1H3 |
| InChIKey | KXLWAOQCGSHHCA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |