C22H24FN5O3 — CID 142885981
[(6Z)-2-[2-(4-fluorophenyl)ethyl]-6-hydrazinylidene-8-(methylideneamino)-1-oxo-7-prop-1-en-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate (PubChem CID 142885981) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is [(6Z)-2-[2-(4-fluorophenyl)ethyl]-6-hydrazinylidene-8-(methylideneamino)-1-oxo-7-prop-1-en-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate.
| Compound Name | [(6Z)-2-[2-(4-fluorophenyl)ethyl]-6-hydrazinylidene-8-(methylideneamino)-1-oxo-7-prop-1-en-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate |
|---|---|
| PubChem CID | 142885981 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [(6Z)-2-[2-(4-fluorophenyl)ethyl]-6-hydrazinylidene-8-(methylideneamino)-1-oxo-7-prop-1-en-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate |
| SMILES | C=Nc1c(OC(C)=O)c2n(/c(=N\N)c1C(=C)C)CCN(CCc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C22H24FN5O3/c1-13(2)17-18(25-4)20(31-14(3)29)19-22(30)27(11-12-28(19)21(17)26-24)10-9-15-5-7-16(23)8-6-15/h5-8H,1,4,9-12,24H2,2-3H3/b26-21- |
| InChIKey | IVCBHEWPHZDPJU-QLYXXIJNSA-N |
| XLogP | 2.39 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|