C20H19FN4O4 — CID 143148954
[(6E)-7-ethenyl-2-[(4-fluorophenyl)methyl]-6-hydroxyimino-8-(methylideneamino)-1-oxo-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate (PubChem CID 143148954) has the molecular formula C20H19FN4O4 and a molecular weight of 398.39 g/mol. Its IUPAC name is [(6E)-7-ethenyl-2-[(4-fluorophenyl)methyl]-6-hydroxyimino-8-(methylideneamino)-1-oxo-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate.
| Compound Name | [(6E)-7-ethenyl-2-[(4-fluorophenyl)methyl]-6-hydroxyimino-8-(methylideneamino)-1-oxo-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate |
|---|---|
| PubChem CID | 143148954 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(6E)-7-ethenyl-2-[(4-fluorophenyl)methyl]-6-hydroxyimino-8-(methylideneamino)-1-oxo-3,4-dihydropyrido[1,2-a]pyrazin-9-yl] acetate |
| SMILES | C=Cc1c(N=C)c(OC(C)=O)c2n(/c1=N/O)CCN(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C20H19FN4O4/c1-4-15-16(22-3)18(29-12(2)26)17-20(27)24(9-10-25(17)19(15)23-28)11-13-5-7-14(21)8-6-13/h4-8,28H,1,3,9-11H2,2H3/b23-19+ |
| InChIKey | DJCMFTXOAUAMDK-FCDQGJHFSA-N |
| XLogP | 2.47 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|