C21H25FN4O3 — CID 146251796
ethyl (E)-3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]prop-2-enoate (PubChem CID 146251796) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 146251796 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl (E)-3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cn(Cc2ccc(F)cc2)c(=O)c(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C21H25FN4O3/c1-3-29-19(27)9-8-18-15-26(14-16-4-6-17(22)7-5-16)21(28)20(23-18)25-12-10-24(2)11-13-25/h4-9,15H,3,10-14H2,1-2H3/b9-8+ |
| InChIKey | JIHFPECDIVEYAB-CMDGGOBGSA-N |
| XLogP | 1.76 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|