C32H38FN3 — CID 142887291
3-[(1E,3E)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]hexa-1,3-dienyl]-N-pent-2-en-2-ylnaphthalen-2-amine (PubChem CID 142887291) has the molecular formula C32H38FN3 and a molecular weight of 483.68 g/mol. Its IUPAC name is 3-[(1E,3E)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]hexa-1,3-dienyl]-N-pent-2-en-2-ylnaphthalen-2-amine.
| Compound Name | 3-[(1E,3E)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]hexa-1,3-dienyl]-N-pent-2-en-2-ylnaphthalen-2-amine |
|---|---|
| PubChem CID | 142887291 |
| Molecular Formula | C32H38FN3 |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 3-[(1E,3E)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]hexa-1,3-dienyl]-N-pent-2-en-2-ylnaphthalen-2-amine |
| SMILES | CCC=C(C)Nc1cc2ccccc2cc1/C=C/C(=C\CC)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H38FN3/c1-4-8-25(3)34-32-23-28-11-7-6-10-27(28)22-29(32)14-17-31(9-5-2)36-20-18-35(19-21-36)24-26-12-15-30(33)16-13-26/h6-17,22-23,34H,4-5,18-21,24H2,1-3H3/b17-14+,25-8?,31-9+ |
| InChIKey | USTDGJPSMXYSKG-DNJTURRGSA-N |
| XLogP | 7.83 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|