C26H27FN4OS2 — CID 142887370
acetylene;(E)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-[6-[(methyldisulfanyl)amino]quinolin-7-yl]prop-2-en-1-one (PubChem CID 142887370) has the molecular formula C26H27FN4OS2 and a molecular weight of 494.66 g/mol. Its IUPAC name is acetylene;(E)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-[6-[(methyldisulfanyl)amino]quinolin-7-yl]prop-2-en-1-one.
| Compound Name | acetylene;(E)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-[6-[(methyldisulfanyl)amino]quinolin-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142887370 |
| Molecular Formula | C26H27FN4OS2 |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | acetylene;(E)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-[6-[(methyldisulfanyl)amino]quinolin-7-yl]prop-2-en-1-one |
| SMILES | C#C.CSSNc1cc2cccnc2cc1/C=C/C(=O)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H25FN4OS2.C2H2/c1-31-32-27-23-16-19-3-2-10-26-22(19)15-20(23)6-9-24(30)29-13-11-28(12-14-29)17-18-4-7-21(25)8-5-18;1-2/h2-10,15-16,27H,11-14,17H2,1H3;1-2H/b9-6+; |
| InChIKey | SNMRJSYUDTYSPS-MLBSPLJJSA-N |
| XLogP | 5.32 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|