C30H38ClFN4O — CID 142887228
acetylene;(E)-3-[4-chloro-2-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 142887228) has the molecular formula C30H38ClFN4O and a molecular weight of 525.11 g/mol. Its IUPAC name is acetylene;(E)-3-[4-chloro-2-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | acetylene;(E)-3-[4-chloro-2-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142887228 |
| Molecular Formula | C30H38ClFN4O |
| Molecular Weight | 525.11 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | acetylene;(E)-3-[4-chloro-2-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C#C.CC(C)N1CCN(Cc2cc(Cl)ccc2/C=C/C(=O)N2CCN(Cc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H36ClFN4O.C2H2/c1-22(2)33-15-11-32(12-16-33)21-25-19-26(29)7-5-24(25)6-10-28(35)34-17-13-31(14-18-34)20-23-3-8-27(30)9-4-23;1-2/h3-10,19,22H,11-18,20-21H2,1-2H3;1-2H/b10-6+; |
| InChIKey | YTGCCQPYFFSBHR-AAGWESIMSA-N |
| XLogP | 4.61 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.11 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|