C25H27FN4O3S — CID 68537936
N-[7-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]quinolin-6-yl]methanesulfonamide (PubChem CID 68537936) has the molecular formula C25H27FN4O3S and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[7-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]quinolin-6-yl]methanesulfonamide.
| Compound Name | N-[7-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]quinolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 68537936 |
| Molecular Formula | C25H27FN4O3S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[7-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]quinolin-6-yl]methanesulfonamide |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)C=Cc1cc2ncccc2cc1NS(C)(=O)=O |
| InChI | InChI=1S/C25H27FN4O3S/c1-18-16-29(17-19-5-8-22(26)9-6-19)12-13-30(18)25(31)10-7-21-14-23-20(4-3-11-27-23)15-24(21)28-34(2,32)33/h3-11,14-15,18,28H,12-13,16-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | HVXRKIFTIHRJAA-GOSISDBHSA-N |
| XLogP | 3.49 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|