C15H19N3O3 — CID 142887755
1-[(1Z,3Z)-hexa-1,3-dienyl]-4-morpholin-4-yl-6-oxopyrimidine-5-carbaldehyde (PubChem CID 142887755) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[(1Z,3Z)-hexa-1,3-dienyl]-4-morpholin-4-yl-6-oxopyrimidine-5-carbaldehyde.
| Compound Name | 1-[(1Z,3Z)-hexa-1,3-dienyl]-4-morpholin-4-yl-6-oxopyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 142887755 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-[(1Z,3Z)-hexa-1,3-dienyl]-4-morpholin-4-yl-6-oxopyrimidine-5-carbaldehyde |
| SMILES | CC/C=C\C=C/n1cnc(N2CCOCC2)c(C=O)c1=O |
| InChI | InChI=1S/C15H19N3O3/c1-2-3-4-5-6-18-12-16-14(13(11-19)15(18)20)17-7-9-21-10-8-17/h3-6,11-12H,2,7-10H2,1H3/b4-3-,6-5- |
| InChIKey | HIYYXJLFYMDFSS-OUPQRBNQSA-N |
| XLogP | 1.33 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|