C26H34F2N3OP — CID 142888437
1-[2-(2,5-difluorophenyl)ethyl]-3-methyl-1-(2-phenylbut-3-en-2-yl)-3-piperidin-4-ylurea;methylidenephosphane (PubChem CID 142888437) has the molecular formula C26H34F2N3OP and a molecular weight of 473.55 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-3-methyl-1-(2-phenylbut-3-en-2-yl)-3-piperidin-4-ylurea;methylidenephosphane.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-methyl-1-(2-phenylbut-3-en-2-yl)-3-piperidin-4-ylurea;methylidenephosphane |
|---|---|
| PubChem CID | 142888437 |
| Molecular Formula | C26H34F2N3OP |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-methyl-1-(2-phenylbut-3-en-2-yl)-3-piperidin-4-ylurea;methylidenephosphane |
| SMILES | C=CC(C)(c1ccccc1)N(CCc1cc(F)ccc1F)C(=O)N(C)C1CCNCC1.[H]P=C |
| InChI | InChI=1S/C25H31F2N3O.CH3P/c1-4-25(2,20-8-6-5-7-9-20)30(17-14-19-18-21(26)10-11-23(19)27)24(31)29(3)22-12-15-28-16-13-22;1-2/h4-11,18,22,28H,1,12-17H2,2-3H3;2H,1H2 |
| InChIKey | DKXSMUXHLFVQKP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|