C75H70N7O5+5 — CID 142891552
[4-[10-(4-cyanatophenyl)-3,6,7-tris(4-formylphenyl)-1,4,5,8,9-pentakis(1-methylpyridin-1-ium-4-yl)decan-2-yl]phenyl] cyanate (PubChem CID 142891552) has the molecular formula C75H70N7O5+5 and a molecular weight of 1149.43 g/mol. Its IUPAC name is [4-[10-(4-cyanatophenyl)-3,6,7-tris(4-formylphenyl)-1,4,5,8,9-pentakis(1-methylpyridin-1-ium-4-yl)decan-2-yl]phenyl] cyanate.
| Compound Name | [4-[10-(4-cyanatophenyl)-3,6,7-tris(4-formylphenyl)-1,4,5,8,9-pentakis(1-methylpyridin-1-ium-4-yl)decan-2-yl]phenyl] cyanate |
|---|---|
| PubChem CID | 142891552 |
| Molecular Formula | C75H70N7O5+5 |
| Molecular Weight | 1149.43 g/mol |
| Exact Mass | 1148.54 |
| IUPAC Name | [4-[10-(4-cyanatophenyl)-3,6,7-tris(4-formylphenyl)-1,4,5,8,9-pentakis(1-methylpyridin-1-ium-4-yl)decan-2-yl]phenyl] cyanate |
| SMILES | C[n+]1ccc(CC(c2ccc(OC#N)cc2)C(c2ccc(C=O)cc2)C(c2cc[n+](C)cc2)C(c2cc[n+](C)cc2)C(c2ccc(C=O)cc2)C(c2ccc(C=O)cc2)C(c2cc[n+](C)cc2)C(Cc2ccc(OC#N)cc2)c2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C75H70N7O5/c1-78-36-26-54(27-37-78)47-68(58-20-24-67(25-21-58)87-52-77)70(60-14-6-55(48-83)7-15-60)73(64-32-42-81(4)43-33-64)75(65-34-44-82(5)45-35-65)74(62-18-10-57(50-85)11-19-62)72(61-16-8-56(49-84)9-17-61)71(63-30-40-80(3)41-31-63)69(59-28-38-79(2)39-29-59)46-53-12-22-66(23-13-53)86-51-76/h6-45,48-50,68-75H,46-47H2,1-5H3/q+5 |
| InChIKey | LYLSGTLKMCLZQV-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 136.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.43 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|