C30H27N3O2+2 — CID 142891553
4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzaldehyde;[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl] cyanate (PubChem CID 142891553) has the molecular formula C30H27N3O2+2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzaldehyde;[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl] cyanate.
| Compound Name | 4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzaldehyde;[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl] cyanate |
|---|---|
| PubChem CID | 142891553 |
| Molecular Formula | C30H27N3O2+2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzaldehyde;[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl] cyanate |
| SMILES | C[n+]1ccc(/C=C/c2ccc(C=O)cc2)cc1.C[n+]1ccc(/C=C/c2ccc(OC#N)cc2)cc1 |
| InChI | InChI=1S/C15H13N2O.C15H14NO/c1-17-10-8-14(9-11-17)3-2-13-4-6-15(7-5-13)18-12-16;1-16-10-8-14(9-11-16)3-2-13-4-6-15(12-17)7-5-13/h2-11H,1H3;2-12H,1H3/q2*+1/b2*3-2+ |
| InChIKey | ISJHFCYVAIXRFP-XQHVRGAUSA-N |
| XLogP | 5.04 |
| TPSA | 57.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|