C17H14ClNO — CID 138653057
[4-[(E)-2-(3-chloro-4,5-dimethylphenyl)ethenyl]phenyl] cyanate (PubChem CID 138653057) has the molecular formula C17H14ClNO and a molecular weight of 283.76 g/mol. Its IUPAC name is [4-[(E)-2-(3-chloro-4,5-dimethylphenyl)ethenyl]phenyl] cyanate.
| Compound Name | [4-[(E)-2-(3-chloro-4,5-dimethylphenyl)ethenyl]phenyl] cyanate |
|---|---|
| PubChem CID | 138653057 |
| Molecular Formula | C17H14ClNO |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [4-[(E)-2-(3-chloro-4,5-dimethylphenyl)ethenyl]phenyl] cyanate |
| SMILES | Cc1cc(/C=C/c2ccc(OC#N)cc2)cc(Cl)c1C |
| InChI | InChI=1S/C17H14ClNO/c1-12-9-15(10-17(18)13(12)2)4-3-14-5-7-16(8-6-14)20-11-19/h3-10H,1-2H3/b4-3+ |
| InChIKey | BTOQELLWZQCYBA-ONEGZZNKSA-N |
| XLogP | 4.99 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|