C24H36N4 — CID 142891850
4-[(3-aminophenyl)-(dipropylamino)methyl]-N,N-diethylbenzenecarboximidamide (PubChem CID 142891850) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is 4-[(3-aminophenyl)-(dipropylamino)methyl]-N,N-diethylbenzenecarboximidamide.
| Compound Name | 4-[(3-aminophenyl)-(dipropylamino)methyl]-N,N-diethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142891850 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 4-[(3-aminophenyl)-(dipropylamino)methyl]-N,N-diethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(C(c2cccc(N)c2)N(CCC)CCC)cc1)N(CC)CC |
| InChI | InChI=1S/C24H36N4/c1-5-16-28(17-6-2)23(21-10-9-11-22(25)18-21)19-12-14-20(15-13-19)24(26)27(7-3)8-4/h9-15,18,23,26H,5-8,16-17,25H2,1-4H3/b26-24- |
| InChIKey | GILMOAOWUJDNAS-LCUIJRPUSA-N |
| XLogP | 5.15 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|