C14H13FN4O4S3 — CID 142892047
1-[3-fluoro-4-[3-[hydroxysulfonothioyl(sulfanyl)amino]-2-oxopyrrolidin-1-yl]phenyl]-2-oxopyrazine (PubChem CID 142892047) has the molecular formula C14H13FN4O4S3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-[3-fluoro-4-[3-[hydroxysulfonothioyl(sulfanyl)amino]-2-oxopyrrolidin-1-yl]phenyl]-2-oxopyrazine.
| Compound Name | 1-[3-fluoro-4-[3-[hydroxysulfonothioyl(sulfanyl)amino]-2-oxopyrrolidin-1-yl]phenyl]-2-oxopyrazine |
|---|---|
| PubChem CID | 142892047 |
| Molecular Formula | C14H13FN4O4S3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1-[3-fluoro-4-[3-[hydroxysulfonothioyl(sulfanyl)amino]-2-oxopyrrolidin-1-yl]phenyl]-2-oxopyrazine |
| SMILES | O=C1C(N(S)S(=O)(O)=S)CCN1c1ccc(-n2ccncc2=O)cc1F |
| InChI | InChI=1S/C14H13FN4O4S3/c15-10-7-9(17-6-4-16-8-13(17)20)1-2-11(10)18-5-3-12(14(18)21)19(24)26(22,23)25/h1-2,4,6-8,12,24H,3,5H2,(H,22,23,25) |
| InChIKey | JEXKGGRIKLVYAY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|