C15H17FIN3O5S2 — CID 142892103
[[1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopyrrolidin-3-yl]-hydroxysulfonothioylamino] hypoiodite (PubChem CID 142892103) has the molecular formula C15H17FIN3O5S2 and a molecular weight of 529.35 g/mol. Its IUPAC name is [[1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopyrrolidin-3-yl]-hydroxysulfonothioylamino] hypoiodite.
| Compound Name | [[1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopyrrolidin-3-yl]-hydroxysulfonothioylamino] hypoiodite |
|---|---|
| PubChem CID | 142892103 |
| Molecular Formula | C15H17FIN3O5S2 |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 528.96 |
| IUPAC Name | [[1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopyrrolidin-3-yl]-hydroxysulfonothioylamino] hypoiodite |
| SMILES | O=C1CCCCN1c1ccc(N2CCC(N(OI)S(=O)(O)=S)C2=O)c(F)c1 |
| InChI | InChI=1S/C15H17FIN3O5S2/c16-11-9-10(18-7-2-1-3-14(18)21)4-5-12(11)19-8-6-13(15(19)22)20(25-17)27(23,24)26/h4-5,9,13H,1-3,6-8H2,(H,23,24,26) |
| InChIKey | WFWRSXJCDHXVAG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|