C17H20FN3O3 — CID 21071195
1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopiperidine-3-carboxamide (PubChem CID 21071195) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopiperidine-3-carboxamide.
| Compound Name | 1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 21071195 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-[2-fluoro-4-(2-oxopiperidin-1-yl)phenyl]-2-oxopiperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ccc(N3CCCCC3=O)cc2F)C1=O |
| InChI | InChI=1S/C17H20FN3O3/c18-13-10-11(20-8-2-1-5-15(20)22)6-7-14(13)21-9-3-4-12(16(19)23)17(21)24/h6-7,10,12H,1-5,8-9H2,(H2,19,23) |
| InChIKey | YLGUVPQWTFOWQD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|