C17H22N4O4S — CID 173179566
(3aR)-1,1-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazole-3-carboxamide (PubChem CID 173179566) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is (3aR)-1,1-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazole-3-carboxamide.
| Compound Name | (3aR)-1,1-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 173179566 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (3aR)-1,1-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazole-3-carboxamide |
| SMILES | NC(=O)C1[C@H]2CCCN2S(=O)(=O)N1c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C17H22N4O4S/c18-17(23)16-14-4-3-11-20(14)26(24,25)21(16)13-8-6-12(7-9-13)19-10-2-1-5-15(19)22/h6-9,14,16H,1-5,10-11H2,(H2,18,23)/t14-,16?/m1/s1 |
| InChIKey | ZNFCLZKHAFHEEY-IURRXHLWSA-N |
| XLogP | 0.59 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |