C22H32N4O2S — CID 142895950
N-[(2S,3R)-4-[(4-aminophenyl)sulfanyl-propylamino]-3-hydroxy-1-phenylbutan-2-yl]-2-(methylamino)acetamide (PubChem CID 142895950) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(4-aminophenyl)sulfanyl-propylamino]-3-hydroxy-1-phenylbutan-2-yl]-2-(methylamino)acetamide.
| Compound Name | N-[(2S,3R)-4-[(4-aminophenyl)sulfanyl-propylamino]-3-hydroxy-1-phenylbutan-2-yl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 142895950 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[(2S,3R)-4-[(4-aminophenyl)sulfanyl-propylamino]-3-hydroxy-1-phenylbutan-2-yl]-2-(methylamino)acetamide |
| SMILES | CCCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)CNC)Sc1ccc(N)cc1 |
| InChI | InChI=1S/C22H32N4O2S/c1-3-13-26(29-19-11-9-18(23)10-12-19)16-21(27)20(25-22(28)15-24-2)14-17-7-5-4-6-8-17/h4-12,20-21,24,27H,3,13-16,23H2,1-2H3,(H,25,28)/t20-,21+/m0/s1 |
| InChIKey | XNKWULOZMZURTQ-LEWJYISDSA-N |
| XLogP | 2.30 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|