C21H26F3N3O5S2 — CID 142896182
1-methylpyrrolidine;5-[[4-nitro-5-(oxan-4-yloxy)thiophen-2-yl]sulfanylamino]-2-(trifluoromethyl)phenol (PubChem CID 142896182) has the molecular formula C21H26F3N3O5S2 and a molecular weight of 521.58 g/mol. Its IUPAC name is 1-methylpyrrolidine;5-[[4-nitro-5-(oxan-4-yloxy)thiophen-2-yl]sulfanylamino]-2-(trifluoromethyl)phenol.
| Compound Name | 1-methylpyrrolidine;5-[[4-nitro-5-(oxan-4-yloxy)thiophen-2-yl]sulfanylamino]-2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 142896182 |
| Molecular Formula | C21H26F3N3O5S2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 1-methylpyrrolidine;5-[[4-nitro-5-(oxan-4-yloxy)thiophen-2-yl]sulfanylamino]-2-(trifluoromethyl)phenol |
| SMILES | CN1CCCC1.O=[N+]([O-])c1cc(SNc2ccc(C(F)(F)F)c(O)c2)sc1OC1CCOCC1 |
| InChI | InChI=1S/C16H15F3N2O5S2.C5H11N/c17-16(18,19)11-2-1-9(7-13(11)22)20-28-14-8-12(21(23)24)15(27-14)26-10-3-5-25-6-4-10;1-6-4-2-3-5-6/h1-2,7-8,10,20,22H,3-6H2;2-5H2,1H3 |
| InChIKey | XYVLSXIDEHYMJO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|