C11H21NS — CID 142896328
ethane;(Z)-N-[(1E)-2-ethyl-1-methylsulfanylbuta-1,3-dienyl]ethanimine (PubChem CID 142896328) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is ethane;(Z)-N-[(1E)-2-ethyl-1-methylsulfanylbuta-1,3-dienyl]ethanimine.
| Compound Name | ethane;(Z)-N-[(1E)-2-ethyl-1-methylsulfanylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 142896328 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | ethane;(Z)-N-[(1E)-2-ethyl-1-methylsulfanylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C/C(CC)=C(\N=C/C)SC.CC |
| InChI | InChI=1S/C9H15NS.C2H6/c1-5-8(6-2)9(11-4)10-7-3;1-2/h5,7H,1,6H2,2-4H3;1-2H3/b9-8-,10-7-; |
| InChIKey | AFEFZZFQENFWAW-WOGDMJOQSA-N |
| XLogP | 4.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|