C10H17NS — CID 171811052
(Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine (PubChem CID 171811052) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine.
| Compound Name | (Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine |
|---|---|
| PubChem CID | 171811052 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine |
| SMILES | C=C(C)C(C)/C=C(\N=C/C)SC |
| InChI | InChI=1S/C10H17NS/c1-6-11-10(12-5)7-9(4)8(2)3/h6-7,9H,2H2,1,3-5H3/b10-7+,11-6- |
| InChIKey | UJJVOHXHGAABHA-SJUGDSPGSA-N |
| XLogP | 3.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|