C12H23NS — CID 171811051
(Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine;ethane (PubChem CID 171811051) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is (Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine;ethane.
| Compound Name | (Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine;ethane |
|---|---|
| PubChem CID | 171811051 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | (Z)-N-[(1E)-3,4-dimethyl-1-methylsulfanylpenta-1,4-dienyl]ethanimine;ethane |
| SMILES | C=C(C)C(C)/C=C(\N=C/C)SC.CC |
| InChI | InChI=1S/C10H17NS.C2H6/c1-6-11-10(12-5)7-9(4)8(2)3;1-2/h6-7,9H,2H2,1,3-5H3;1-2H3/b10-7+,11-6-; |
| InChIKey | GWAKVHVVORKDDP-TTXYLJNJSA-N |
| XLogP | 4.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|