C21H14F8NO2PS — CID 142896410
2-[difluoro(phosphanyl)methyl]-5-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylamino]phenol (PubChem CID 142896410) has the molecular formula C21H14F8NO2PS and a molecular weight of 527.37 g/mol. Its IUPAC name is 2-[difluoro(phosphanyl)methyl]-5-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylamino]phenol.
| Compound Name | 2-[difluoro(phosphanyl)methyl]-5-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylamino]phenol |
|---|---|
| PubChem CID | 142896410 |
| Molecular Formula | C21H14F8NO2PS |
| Molecular Weight | 527.37 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | 2-[difluoro(phosphanyl)methyl]-5-[[3-(trifluoromethyl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylamino]phenol |
| SMILES | Oc1cc(NSc2ccc(Oc3ccc(C(F)(F)F)cc3)c(C(F)(F)F)c2)ccc1C(F)(F)P |
| InChI | InChI=1S/C21H14F8NO2PS/c22-19(23,24)11-1-4-13(5-2-11)32-18-8-6-14(10-16(18)20(25,26)27)34-30-12-3-7-15(17(31)9-12)21(28,29)33/h1-10,30-31H,33H2 |
| InChIKey | VLBWXEZDYVTPIU-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.37 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|