C23H17N3O2 — CID 142897864
1-[4-[(1E)-1-hydroxybuta-1,3-dien-2-yl]phenyl]-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile (PubChem CID 142897864) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-[4-[(1E)-1-hydroxybuta-1,3-dien-2-yl]phenyl]-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile.
| Compound Name | 1-[4-[(1E)-1-hydroxybuta-1,3-dien-2-yl]phenyl]-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile |
|---|---|
| PubChem CID | 142897864 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[4-[(1E)-1-hydroxybuta-1,3-dien-2-yl]phenyl]-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile |
| SMILES | C=C/C(=C\O)c1ccc(-n2c(=O)c(C#N)cc3c2c2ccccc2n3C)cc1 |
| InChI | InChI=1S/C23H17N3O2/c1-3-15(14-27)16-8-10-18(11-9-16)26-22-19-6-4-5-7-20(19)25(2)21(22)12-17(13-24)23(26)28/h3-12,14,27H,1H2,2H3/b15-14+ |
| InChIKey | OVPVNUNMOZZELX-CCEZHUSRSA-N |
| XLogP | 4.44 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|