C19H13ClN4O2 — CID 24812051
1-(6-chloro-3-pyridinyl)-8-methoxy-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile (PubChem CID 24812051) has the molecular formula C19H13ClN4O2 and a molecular weight of 364.79 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-8-methoxy-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile.
| Compound Name | 1-(6-chloro-3-pyridinyl)-8-methoxy-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile |
|---|---|
| PubChem CID | 24812051 |
| Molecular Formula | C19H13ClN4O2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-8-methoxy-5-methyl-2-oxopyrido[3,2-b]indole-3-carbonitrile |
| SMILES | COc1ccc2c(c1)c1c(cc(C#N)c(=O)n1-c1ccc(Cl)nc1)n2C |
| InChI | InChI=1S/C19H13ClN4O2/c1-23-15-5-4-13(26-2)8-14(15)18-16(23)7-11(9-21)19(25)24(18)12-3-6-17(20)22-10-12/h3-8,10H,1-2H3 |
| InChIKey | ULRPJNIRJUROGW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|