C22H22ClN2O4S+ — CID 142899350
N-[4-chloro-2-(1-hydroxy-2-methylpyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfinamide (PubChem CID 142899350) has the molecular formula C22H22ClN2O4S+ and a molecular weight of 445.95 g/mol. Its IUPAC name is N-[4-chloro-2-(1-hydroxy-2-methylpyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfinamide.
| Compound Name | N-[4-chloro-2-(1-hydroxy-2-methylpyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfinamide |
|---|---|
| PubChem CID | 142899350 |
| Molecular Formula | C22H22ClN2O4S+ |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[4-chloro-2-(1-hydroxy-2-methylpyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfinamide |
| SMILES | Cc1cc(C(=O)c2cc(Cl)ccc2NS(=O)c2ccc(OC(C)C)cc2)cc[n+]1O |
| InChI | InChI=1S/C22H21ClN2O4S/c1-14(2)29-18-5-7-19(8-6-18)30(28)24-21-9-4-17(23)13-20(21)22(26)16-10-11-25(27)15(3)12-16/h4-14H,1-3H3,(H-,24,26,27)/p+1 |
| InChIKey | YHTYNDSIRFPLML-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|