C9H15F2NO — CID 142900456
2-[1-(1,1-difluoroethyl)cyclobutyl]propanamide (PubChem CID 142900456) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is 2-[1-(1,1-difluoroethyl)cyclobutyl]propanamide.
| Compound Name | 2-[1-(1,1-difluoroethyl)cyclobutyl]propanamide |
|---|---|
| PubChem CID | 142900456 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-[1-(1,1-difluoroethyl)cyclobutyl]propanamide |
| SMILES | CC(C(N)=O)C1(C(C)(F)F)CCC1 |
| InChI | InChI=1S/C9H15F2NO/c1-6(7(12)13)9(4-3-5-9)8(2,10)11/h6H,3-5H2,1-2H3,(H2,12,13) |
| InChIKey | DLSDOGJJQWNTEP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |