C29H34FN3O2 — CID 142901431
ethane;1-[8-fluoro-4-(methylamino)quinolin-3-yl]ethanone;N-[(3-methylphenyl)methoxy]-1-phenylmethanamine (PubChem CID 142901431) has the molecular formula C29H34FN3O2 and a molecular weight of 475.61 g/mol. Its IUPAC name is ethane;1-[8-fluoro-4-(methylamino)quinolin-3-yl]ethanone;N-[(3-methylphenyl)methoxy]-1-phenylmethanamine.
| Compound Name | ethane;1-[8-fluoro-4-(methylamino)quinolin-3-yl]ethanone;N-[(3-methylphenyl)methoxy]-1-phenylmethanamine |
|---|---|
| PubChem CID | 142901431 |
| Molecular Formula | C29H34FN3O2 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | ethane;1-[8-fluoro-4-(methylamino)quinolin-3-yl]ethanone;N-[(3-methylphenyl)methoxy]-1-phenylmethanamine |
| SMILES | CC.CNc1c(C(C)=O)cnc2c(F)cccc12.Cc1cccc(CONCc2ccccc2)c1 |
| InChI | InChI=1S/C15H17NO.C12H11FN2O.C2H6/c1-13-6-5-9-15(10-13)12-17-16-11-14-7-3-2-4-8-14;1-7(16)9-6-15-12-8(11(9)14-2)4-3-5-10(12)13;1-2/h2-10,16H,11-12H2,1H3;3-6H,1-2H3,(H,14,15);1-2H3 |
| InChIKey | ZPAWWUNCULBUQA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|