C28H34Cl2N6O2 — CID 142904949
4-[[3-(2,4-dichlorophenyl)-2-oxo-8-propan-2-yl-1,3-diazaspiro[4.5]decan-1-yl]methyl]-N-[N'-methyl-N-(methylideneamino)carbamimidoyl]benzamide (PubChem CID 142904949) has the molecular formula C28H34Cl2N6O2 and a molecular weight of 557.53 g/mol. Its IUPAC name is 4-[[3-(2,4-dichlorophenyl)-2-oxo-8-propan-2-yl-1,3-diazaspiro[4.5]decan-1-yl]methyl]-N-[N'-methyl-N-(methylideneamino)carbamimidoyl]benzamide.
| Compound Name | 4-[[3-(2,4-dichlorophenyl)-2-oxo-8-propan-2-yl-1,3-diazaspiro[4.5]decan-1-yl]methyl]-N-[N'-methyl-N-(methylideneamino)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 142904949 |
| Molecular Formula | C28H34Cl2N6O2 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 4-[[3-(2,4-dichlorophenyl)-2-oxo-8-propan-2-yl-1,3-diazaspiro[4.5]decan-1-yl]methyl]-N-[N'-methyl-N-(methylideneamino)carbamimidoyl]benzamide |
| SMILES | C=NN/C(=N\C)NC(=O)c1ccc(CN2C(=O)N(c3ccc(Cl)cc3Cl)CC23CCC(C(C)C)CC3)cc1 |
| InChI | InChI=1S/C28H34Cl2N6O2/c1-18(2)20-11-13-28(14-12-20)17-35(24-10-9-22(29)15-23(24)30)27(38)36(28)16-19-5-7-21(8-6-19)25(37)33-26(31-3)34-32-4/h5-10,15,18,20H,4,11-14,16-17H2,1-3H3,(H2,31,33,34,37) |
| InChIKey | YLNUNLQSOKDXJK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|