C21H25NO2S — CID 142906562
N-[3-[(1E,3E)-2-(2-ethylphenyl)-3-methylpenta-1,3-dienyl]phenyl]methanesulfonamide (PubChem CID 142906562) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is N-[3-[(1E,3E)-2-(2-ethylphenyl)-3-methylpenta-1,3-dienyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(1E,3E)-2-(2-ethylphenyl)-3-methylpenta-1,3-dienyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 142906562 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[3-[(1E,3E)-2-(2-ethylphenyl)-3-methylpenta-1,3-dienyl]phenyl]methanesulfonamide |
| SMILES | C/C=C(C)/C(=C\c1cccc(NS(C)(=O)=O)c1)c1ccccc1CC |
| InChI | InChI=1S/C21H25NO2S/c1-5-16(3)21(20-13-8-7-11-18(20)6-2)15-17-10-9-12-19(14-17)22-25(4,23)24/h5,7-15,22H,6H2,1-4H3/b16-5+,21-15+ |
| InChIKey | YNTDQVNWUJMSFM-MLNWEQHVSA-N |
| XLogP | 5.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|